C12H21NO2 — CID 89374191
N-[(1S,2R)-2-(hydroxymethyl)cyclohexyl]pent-4-enamide (PubChem CID 89374191) has the molecular formula C12H21NO2 and a molecular weight of 211.30 g/mol. Its IUPAC name is N-[(1S,2R)-2-(hydroxymethyl)cyclohexyl]pent-4-enamide.
| Compound Name | N-[(1S,2R)-2-(hydroxymethyl)cyclohexyl]pent-4-enamide |
|---|---|
| PubChem CID | 89374191 |
| Molecular Formula | C12H21NO2 |
| Molecular Weight | 211.30 g/mol |
| Exact Mass | 211.16 |
| IUPAC Name | N-[(1S,2R)-2-(hydroxymethyl)cyclohexyl]pent-4-enamide |
| SMILES | C=CCCC(=O)N[C@H]1CCCC[C@H]1CO |
| InChI | InChI=1S/C12H21NO2/c1-2-3-8-12(15)13-11-7-5-4-6-10(11)9-14/h2,10-11,14H,1,3-9H2,(H,13,15)/t10-,11-/m0/s1 |
| InChIKey | HFNWQJBQXSNPAK-QWRGUYRKSA-N |
| XLogP | 1.62 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.30 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|