About 1,5-dihydro-2-benzoxepine
1,5-dihydro-2-benzoxepine (PubChem CID 89374438) has the molecular formula C10H10O
and a molecular weight of 146.19 g/mol. Its IUPAC name is 1,5-dihydro-2-benzoxepine.
Molecular Properties
| Compound Name | 1,5-dihydro-2-benzoxepine |
| PubChem CID | 89374438 |
| Molecular Formula | C10H10O |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.07 |
| IUPAC Name | 1,5-dihydro-2-benzoxepine |
| SMILES | C1=COCc2ccccc2C1 |
| InChI | InChI=1S/C10H10O/c1-2-5-10-8-11-7-3-6-9(10)4-1/h1-5,7H,6,8H2 |
| InChIKey | GEXXUVOMFIUKAA-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,5-dihydro-2-benzoxepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-dihydro-2-benzoxepine?
The IUPAC name of 1,5-dihydro-2-benzoxepine (CID 89374438) is 1,5-dihydro-2-benzoxepine.
What is the SMILES notation for 1,5-dihydro-2-benzoxepine?
The canonical SMILES for 1,5-dihydro-2-benzoxepine is C1=COCc2ccccc2C1.
What is the InChIKey of 1,5-dihydro-2-benzoxepine?
The InChIKey is GEXXUVOMFIUKAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O/c1-2-5-10-8-11-7-3-6-9(10)4-1/h1-5,7H,6,8H2.
What are the key properties of 1,5-dihydro-2-benzoxepine?
1,5-dihydro-2-benzoxepine has a molecular weight of 146.19 g/mol, XLogP of 2.27, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-dihydro-2-benzoxepine is sourced from PubChem (CID 89374438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).