About (4-methylphenyl)methyl 2,3,4,5-tetraoxopentanoate
(4-methylphenyl)methyl 2,3,4,5-tetraoxopentanoate (PubChem CID 89374582) has the molecular formula C13H10O6
and a molecular weight of 262.22 g/mol. Its IUPAC name is (4-methylphenyl)methyl 2,3,4,5-tetraoxopentanoate.
Molecular Properties
| Compound Name | (4-methylphenyl)methyl 2,3,4,5-tetraoxopentanoate |
| PubChem CID | 89374582 |
| Molecular Formula | C13H10O6 |
| Molecular Weight | 262.22 g/mol |
| Exact Mass | 262.05 |
| IUPAC Name | (4-methylphenyl)methyl 2,3,4,5-tetraoxopentanoate |
| SMILES | Cc1ccc(COC(=O)C(=O)C(=O)C(=O)C=O)cc1 |
| InChI | InChI=1S/C13H10O6/c1-8-2-4-9(5-3-8)7-19-13(18)12(17)11(16)10(15)6-14/h2-6H,7H2,1H3 |
| InChIKey | LQRCGWHCCIJQGW-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 94.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.22 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze (4-methylphenyl)methyl 2,3,4,5-tetraoxopentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methylphenyl)methyl 2,3,4,5-tetraoxopentanoate?
The IUPAC name of (4-methylphenyl)methyl 2,3,4,5-tetraoxopentanoate (CID 89374582) is (4-methylphenyl)methyl 2,3,4,5-tetraoxopentanoate.
What is the SMILES notation for (4-methylphenyl)methyl 2,3,4,5-tetraoxopentanoate?
The canonical SMILES for (4-methylphenyl)methyl 2,3,4,5-tetraoxopentanoate is Cc1ccc(COC(=O)C(=O)C(=O)C(=O)C=O)cc1.
What is the InChIKey of (4-methylphenyl)methyl 2,3,4,5-tetraoxopentanoate?
The InChIKey is LQRCGWHCCIJQGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10O6/c1-8-2-4-9(5-3-8)7-19-13(18)12(17)11(16)10(15)6-14/h2-6H,7H2,1H3.
What are the key properties of (4-methylphenyl)methyl 2,3,4,5-tetraoxopentanoate?
(4-methylphenyl)methyl 2,3,4,5-tetraoxopentanoate has a molecular weight of 262.22 g/mol, XLogP of -0.06, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methylphenyl)methyl 2,3,4,5-tetraoxopentanoate is sourced from PubChem (CID 89374582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).