About 5-ethyl-1,4-dihydropyrimidin-2-amine
5-ethyl-1,4-dihydropyrimidin-2-amine (PubChem CID 89374650) has the molecular formula C6H11N3
and a molecular weight of 125.17 g/mol. Its IUPAC name is 5-ethyl-1,4-dihydropyrimidin-2-amine.
Molecular Properties
| Compound Name | 5-ethyl-1,4-dihydropyrimidin-2-amine |
| PubChem CID | 89374650 |
| Molecular Formula | C6H11N3 |
| Molecular Weight | 125.17 g/mol |
| Exact Mass | 125.10 |
| IUPAC Name | 5-ethyl-1,4-dihydropyrimidin-2-amine |
| SMILES | CCC1=CNC(N)=NC1 |
| InChI | InChI=1S/C6H11N3/c1-2-5-3-8-6(7)9-4-5/h3H,2,4H2,1H3,(H3,7,8,9) |
| InChIKey | BSFDURLQIRNIIE-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.17 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-ethyl-1,4-dihydropyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-1,4-dihydropyrimidin-2-amine?
The IUPAC name of 5-ethyl-1,4-dihydropyrimidin-2-amine (CID 89374650) is 5-ethyl-1,4-dihydropyrimidin-2-amine.
What is the SMILES notation for 5-ethyl-1,4-dihydropyrimidin-2-amine?
The canonical SMILES for 5-ethyl-1,4-dihydropyrimidin-2-amine is CCC1=CNC(N)=NC1.
What is the InChIKey of 5-ethyl-1,4-dihydropyrimidin-2-amine?
The InChIKey is BSFDURLQIRNIIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N3/c1-2-5-3-8-6(7)9-4-5/h3H,2,4H2,1H3,(H3,7,8,9).
What are the key properties of 5-ethyl-1,4-dihydropyrimidin-2-amine?
5-ethyl-1,4-dihydropyrimidin-2-amine has a molecular weight of 125.17 g/mol, XLogP of 0.20, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-1,4-dihydropyrimidin-2-amine is sourced from PubChem (CID 89374650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).