About N'-methyl-1,4-dioxa-8-azaspiro[4.5]decane-8-carboximidamide
N'-methyl-1,4-dioxa-8-azaspiro[4.5]decane-8-carboximidamide (PubChem CID 89374677) has the molecular formula C9H17N3O2
and a molecular weight of 199.25 g/mol. Its IUPAC name is N'-methyl-1,4-dioxa-8-azaspiro[4.5]decane-8-carboximidamide.
Molecular Properties
| Compound Name | N'-methyl-1,4-dioxa-8-azaspiro[4.5]decane-8-carboximidamide |
| PubChem CID | 89374677 |
| Molecular Formula | C9H17N3O2 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.13 |
| IUPAC Name | N'-methyl-1,4-dioxa-8-azaspiro[4.5]decane-8-carboximidamide |
| SMILES | C/N=C(\N)N1CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C9H17N3O2/c1-11-8(10)12-4-2-9(3-5-12)13-6-7-14-9/h2-7H2,1H3,(H2,10,11) |
| InChIKey | MMZVJZNKPFJALV-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 60.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-methyl-1,4-dioxa-8-azaspiro[4.5]decane-8-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-methyl-1,4-dioxa-8-azaspiro[4.5]decane-8-carboximidamide?
The IUPAC name of N'-methyl-1,4-dioxa-8-azaspiro[4.5]decane-8-carboximidamide (CID 89374677) is N'-methyl-1,4-dioxa-8-azaspiro[4.5]decane-8-carboximidamide.
What is the SMILES notation for N'-methyl-1,4-dioxa-8-azaspiro[4.5]decane-8-carboximidamide?
The canonical SMILES for N'-methyl-1,4-dioxa-8-azaspiro[4.5]decane-8-carboximidamide is C/N=C(\N)N1CCC2(CC1)OCCO2.
What is the InChIKey of N'-methyl-1,4-dioxa-8-azaspiro[4.5]decane-8-carboximidamide?
The InChIKey is MMZVJZNKPFJALV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N3O2/c1-11-8(10)12-4-2-9(3-5-12)13-6-7-14-9/h2-7H2,1H3,(H2,10,11).
What are the key properties of N'-methyl-1,4-dioxa-8-azaspiro[4.5]decane-8-carboximidamide?
N'-methyl-1,4-dioxa-8-azaspiro[4.5]decane-8-carboximidamide has a molecular weight of 199.25 g/mol, XLogP of -0.23, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-methyl-1,4-dioxa-8-azaspiro[4.5]decane-8-carboximidamide is sourced from PubChem (CID 89374677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).