About 1,4-dimethylidenepiperazine-1,4-diium
1,4-dimethylidenepiperazine-1,4-diium (PubChem CID 89374723) has the molecular formula C6H12N2+2
and a molecular weight of 112.18 g/mol. Its IUPAC name is 1,4-dimethylidenepiperazine-1,4-diium.
Molecular Properties
| Compound Name | 1,4-dimethylidenepiperazine-1,4-diium |
| PubChem CID | 89374723 |
| Molecular Formula | C6H12N2+2 |
| Molecular Weight | 112.18 g/mol |
| Exact Mass | 112.10 |
| IUPAC Name | 1,4-dimethylidenepiperazine-1,4-diium |
| SMILES | C=[N+]1CC[N+](=C)CC1 |
| InChI | InChI=1S/C6H12N2/c1-7-3-5-8(2)6-4-7/h1-6H2/q+2 |
| InChIKey | QKJONIBYAWCPCD-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 6.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 112.18 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1,4-dimethylidenepiperazine-1,4-diium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dimethylidenepiperazine-1,4-diium?
The IUPAC name of 1,4-dimethylidenepiperazine-1,4-diium (CID 89374723) is 1,4-dimethylidenepiperazine-1,4-diium.
What is the SMILES notation for 1,4-dimethylidenepiperazine-1,4-diium?
The canonical SMILES for 1,4-dimethylidenepiperazine-1,4-diium is C=[N+]1CC[N+](=C)CC1.
What is the InChIKey of 1,4-dimethylidenepiperazine-1,4-diium?
The InChIKey is QKJONIBYAWCPCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2/c1-7-3-5-8(2)6-4-7/h1-6H2/q+2.
What are the key properties of 1,4-dimethylidenepiperazine-1,4-diium?
1,4-dimethylidenepiperazine-1,4-diium has a molecular weight of 112.18 g/mol, XLogP of -0.57, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dimethylidenepiperazine-1,4-diium is sourced from PubChem (CID 89374723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).