About [6-[bis(trimethyl-λ4-sulfanyl)methyl]-2-pyridinyl]methanol
[6-[bis(trimethyl-λ4-sulfanyl)methyl]-2-pyridinyl]methanol (PubChem CID 89375470) has the molecular formula C13H25NOS2
and a molecular weight of 275.48 g/mol. Its IUPAC name is [6-[bis(trimethyl-λ4-sulfanyl)methyl]-2-pyridinyl]methanol.
Molecular Properties
| Compound Name | [6-[bis(trimethyl-λ4-sulfanyl)methyl]-2-pyridinyl]methanol |
| PubChem CID | 89375470 |
| Molecular Formula | C13H25NOS2 |
| Molecular Weight | 275.48 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | [6-[bis(trimethyl-λ4-sulfanyl)methyl]-2-pyridinyl]methanol |
| SMILES | CS(C)(C)C(c1cccc(CO)n1)S(C)(C)C |
| InChI | InChI=1S/C13H25NOS2/c1-16(2,3)13(17(4,5)6)12-9-7-8-11(10-15)14-12/h7-9,13,15H,10H2,1-6H3 |
| InChIKey | AKDNCCHHOOBQRD-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.48 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [6-[bis(trimethyl-λ4-sulfanyl)methyl]-2-pyridinyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-[bis(trimethyl-λ4-sulfanyl)methyl]-2-pyridinyl]methanol?
The IUPAC name of [6-[bis(trimethyl-λ4-sulfanyl)methyl]-2-pyridinyl]methanol (CID 89375470) is [6-[bis(trimethyl-λ4-sulfanyl)methyl]-2-pyridinyl]methanol.
What is the SMILES notation for [6-[bis(trimethyl-λ4-sulfanyl)methyl]-2-pyridinyl]methanol?
The canonical SMILES for [6-[bis(trimethyl-λ4-sulfanyl)methyl]-2-pyridinyl]methanol is CS(C)(C)C(c1cccc(CO)n1)S(C)(C)C.
What is the InChIKey of [6-[bis(trimethyl-λ4-sulfanyl)methyl]-2-pyridinyl]methanol?
The InChIKey is AKDNCCHHOOBQRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25NOS2/c1-16(2,3)13(17(4,5)6)12-9-7-8-11(10-15)14-12/h7-9,13,15H,10H2,1-6H3.
What are the key properties of [6-[bis(trimethyl-λ4-sulfanyl)methyl]-2-pyridinyl]methanol?
[6-[bis(trimethyl-λ4-sulfanyl)methyl]-2-pyridinyl]methanol has a molecular weight of 275.48 g/mol, XLogP of 2.96, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [6-[bis(trimethyl-λ4-sulfanyl)methyl]-2-pyridinyl]methanol is sourced from PubChem (CID 89375470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).