C61H74NO+ — CID 89375558
4-[2,6-bis[4-(1-adamantyl)phenyl]-4-(4-tert-butylphenyl)pyridin-1-ium-1-yl]-2,6-ditert-butylphenol (PubChem CID 89375558) has the molecular formula C61H74NO+ and a molecular weight of 837.27 g/mol. Its IUPAC name is 4-[2,6-bis[4-(1-adamantyl)phenyl]-4-(4-tert-butylphenyl)pyridin-1-ium-1-yl]-2,6-ditert-butylphenol.
| Compound Name | 4-[2,6-bis[4-(1-adamantyl)phenyl]-4-(4-tert-butylphenyl)pyridin-1-ium-1-yl]-2,6-ditert-butylphenol |
|---|---|
| PubChem CID | 89375558 |
| Molecular Formula | C61H74NO+ |
| Molecular Weight | 837.27 g/mol |
| Exact Mass | 836.58 |
| IUPAC Name | 4-[2,6-bis[4-(1-adamantyl)phenyl]-4-(4-tert-butylphenyl)pyridin-1-ium-1-yl]-2,6-ditert-butylphenol |
| SMILES | CC(C)(C)c1ccc(-c2cc(-c3ccc(C45CC6CC(CC(C6)C4)C5)cc3)[n+](-c3cc(C(C)(C)C)c(O)c(C(C)(C)C)c3)c(-c3ccc(C45CC6CC(CC(C6)C4)C5)cc3)c2)cc1 |
| InChI | InChI=1S/C61H73NO/c1-57(2,3)48-16-10-44(11-17-48)47-28-54(45-12-18-49(19-13-45)60-32-38-22-39(33-60)24-40(23-38)34-60)62(51-30-52(58(4,5)6)56(63)53(31-51)59(7,8)9)55(29-47)46-14-20-50(21-15-46)61-35-41-25-42(36-61)27-43(26-41)37-61/h10-21,28-31,38-43H,22-27,32-37H2,1-9H3/p+1 |
| InChIKey | YQKAAVJKKNQVNG-UHFFFAOYSA-O |
| XLogP | 15.50 |
| TPSA | 24.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 837.27 |
| LogP ≤ 5 | 15.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|