About 2,4-difluoro-3,6-dimethyl-5-(methylideneamino)phenol
2,4-difluoro-3,6-dimethyl-5-(methylideneamino)phenol (PubChem CID 89375592) has the molecular formula C9H9F2NO
and a molecular weight of 185.17 g/mol. Its IUPAC name is 2,4-difluoro-3,6-dimethyl-5-(methylideneamino)phenol.
Molecular Properties
| Compound Name | 2,4-difluoro-3,6-dimethyl-5-(methylideneamino)phenol |
| PubChem CID | 89375592 |
| Molecular Formula | C9H9F2NO |
| Molecular Weight | 185.17 g/mol |
| Exact Mass | 185.07 |
| IUPAC Name | 2,4-difluoro-3,6-dimethyl-5-(methylideneamino)phenol |
| SMILES | C=Nc1c(C)c(O)c(F)c(C)c1F |
| InChI | InChI=1S/C9H9F2NO/c1-4-6(10)8(12-3)5(2)9(13)7(4)11/h13H,3H2,1-2H3 |
| InChIKey | YCJCCQWVZPGOTD-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.17 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2,4-difluoro-3,6-dimethyl-5-(methylideneamino)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-difluoro-3,6-dimethyl-5-(methylideneamino)phenol?
The IUPAC name of 2,4-difluoro-3,6-dimethyl-5-(methylideneamino)phenol (CID 89375592) is 2,4-difluoro-3,6-dimethyl-5-(methylideneamino)phenol.
What is the SMILES notation for 2,4-difluoro-3,6-dimethyl-5-(methylideneamino)phenol?
The canonical SMILES for 2,4-difluoro-3,6-dimethyl-5-(methylideneamino)phenol is C=Nc1c(C)c(O)c(F)c(C)c1F.
What is the InChIKey of 2,4-difluoro-3,6-dimethyl-5-(methylideneamino)phenol?
The InChIKey is YCJCCQWVZPGOTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9F2NO/c1-4-6(10)8(12-3)5(2)9(13)7(4)11/h13H,3H2,1-2H3.
What are the key properties of 2,4-difluoro-3,6-dimethyl-5-(methylideneamino)phenol?
2,4-difluoro-3,6-dimethyl-5-(methylideneamino)phenol has a molecular weight of 185.17 g/mol, XLogP of 2.62, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-difluoro-3,6-dimethyl-5-(methylideneamino)phenol is sourced from PubChem (CID 89375592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).