C27H26O8 — CID 89375628
2-cyclohexa-1,5-dien-1-yl-5-[(2E,4E)-5-(2-cyclohexa-1,5-dien-1-yl-4-hydroxy-2-methyl-6-oxo-1,3-dioxin-5-yl)penta-2,4-dienylidene]-2-methyl-1,3-dioxane-4,6-dione (PubChem CID 89375628) has the molecular formula C27H26O8 and a molecular weight of 478.50 g/mol. Its IUPAC name is 2-cyclohexa-1,5-dien-1-yl-5-[(2E,4E)-5-(2-cyclohexa-1,5-dien-1-yl-4-hydroxy-2-methyl-6-oxo-1,3-dioxin-5-yl)penta-2,4-dienylidene]-2-methyl-1,3-dioxane-4,6-dione.
| Compound Name | 2-cyclohexa-1,5-dien-1-yl-5-[(2E,4E)-5-(2-cyclohexa-1,5-dien-1-yl-4-hydroxy-2-methyl-6-oxo-1,3-dioxin-5-yl)penta-2,4-dienylidene]-2-methyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 89375628 |
| Molecular Formula | C27H26O8 |
| Molecular Weight | 478.50 g/mol |
| Exact Mass | 478.16 |
| IUPAC Name | 2-cyclohexa-1,5-dien-1-yl-5-[(2E,4E)-5-(2-cyclohexa-1,5-dien-1-yl-4-hydroxy-2-methyl-6-oxo-1,3-dioxin-5-yl)penta-2,4-dienylidene]-2-methyl-1,3-dioxane-4,6-dione |
| SMILES | CC1(C2=CCCC=C2)OC(=O)C(=C/C=C/C=C/C2=C(O)OC(C)(C3=CCCC=C3)OC2=O)C(=O)O1 |
| InChI | InChI=1S/C27H26O8/c1-26(18-12-6-3-7-13-18)32-22(28)20(23(29)33-26)16-10-5-11-17-21-24(30)34-27(2,35-25(21)31)19-14-8-4-9-15-19/h5-6,8,10-17,28H,3-4,7,9H2,1-2H3/b11-5+,16-10+,21-17- |
| InChIKey | WTWXBVXKSCWHMO-JDVHPPHZSA-N |
| XLogP | 4.45 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.50 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|