About (2-quinolin-2-ylphenanthro[10,9-b]thiophen-9-yl) trifluoromethanesulfonate
(2-quinolin-2-ylphenanthro[10,9-b]thiophen-9-yl) trifluoromethanesulfonate (PubChem CID 89375699) has the molecular formula C26H14F3NO3S2
and a molecular weight of 509.53 g/mol. Its IUPAC name is (2-quinolin-2-ylphenanthro[10,9-b]thiophen-9-yl) trifluoromethanesulfonate.
Molecular Properties
| Compound Name | (2-quinolin-2-ylphenanthro[10,9-b]thiophen-9-yl) trifluoromethanesulfonate |
| PubChem CID | 89375699 |
| Molecular Formula | C26H14F3NO3S2 |
| Molecular Weight | 509.53 g/mol |
| Exact Mass | 509.04 |
| IUPAC Name | (2-quinolin-2-ylphenanthro[10,9-b]thiophen-9-yl) trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1ccc2c(c1)c1ccccc1c1cc(-c3ccc4ccccc4n3)sc21)C(F)(F)F |
| InChI | InChI=1S/C26H14F3NO3S2/c27-26(28,29)35(31,32)33-16-10-11-19-20(13-16)17-6-2-3-7-18(17)21-14-24(34-25(19)21)23-12-9-15-5-1-4-8-22(15)30-23/h1-14H |
| InChIKey | IWUONFGRGDEYRB-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 509.53 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze (2-quinolin-2-ylphenanthro[10,9-b]thiophen-9-yl) trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-quinolin-2-ylphenanthro[10,9-b]thiophen-9-yl) trifluoromethanesulfonate?
The IUPAC name of (2-quinolin-2-ylphenanthro[10,9-b]thiophen-9-yl) trifluoromethanesulfonate (CID 89375699) is (2-quinolin-2-ylphenanthro[10,9-b]thiophen-9-yl) trifluoromethanesulfonate.
What is the SMILES notation for (2-quinolin-2-ylphenanthro[10,9-b]thiophen-9-yl) trifluoromethanesulfonate?
The canonical SMILES for (2-quinolin-2-ylphenanthro[10,9-b]thiophen-9-yl) trifluoromethanesulfonate is O=S(=O)(Oc1ccc2c(c1)c1ccccc1c1cc(-c3ccc4ccccc4n3)sc21)C(F)(F)F.
What is the InChIKey of (2-quinolin-2-ylphenanthro[10,9-b]thiophen-9-yl) trifluoromethanesulfonate?
The InChIKey is IWUONFGRGDEYRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H14F3NO3S2/c27-26(28,29)35(31,32)33-16-10-11-19-20(13-16)17-6-2-3-7-18(17)21-14-24(34-25(19)21)23-12-9-15-5-1-4-8-22(15)30-23/h1-14H.
What are the key properties of (2-quinolin-2-ylphenanthro[10,9-b]thiophen-9-yl) trifluoromethanesulfonate?
(2-quinolin-2-ylphenanthro[10,9-b]thiophen-9-yl) trifluoromethanesulfonate has a molecular weight of 509.53 g/mol, XLogP of 7.65, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-quinolin-2-ylphenanthro[10,9-b]thiophen-9-yl) trifluoromethanesulfonate is sourced from PubChem (CID 89375699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).