About 1-methoxypropan-2-ol;pentan-3-one
1-methoxypropan-2-ol;pentan-3-one (PubChem CID 89375765) has the molecular formula C9H20O3
and a molecular weight of 176.26 g/mol. Its IUPAC name is 1-methoxypropan-2-ol;pentan-3-one.
Molecular Properties
| Compound Name | 1-methoxypropan-2-ol;pentan-3-one |
| PubChem CID | 89375765 |
| Molecular Formula | C9H20O3 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.14 |
| IUPAC Name | 1-methoxypropan-2-ol;pentan-3-one |
| SMILES | CCC(=O)CC.COCC(C)O |
| InChI | InChI=1S/C5H10O.C4H10O2/c1-3-5(6)4-2;1-4(5)3-6-2/h3-4H2,1-2H3;4-5H,3H2,1-2H3 |
| InChIKey | FGQAZWCWHQCEQX-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-methoxypropan-2-ol;pentan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxypropan-2-ol;pentan-3-one?
The IUPAC name of 1-methoxypropan-2-ol;pentan-3-one (CID 89375765) is 1-methoxypropan-2-ol;pentan-3-one.
What is the SMILES notation for 1-methoxypropan-2-ol;pentan-3-one?
The canonical SMILES for 1-methoxypropan-2-ol;pentan-3-one is CCC(=O)CC.COCC(C)O.
What is the InChIKey of 1-methoxypropan-2-ol;pentan-3-one?
The InChIKey is FGQAZWCWHQCEQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O.C4H10O2/c1-3-5(6)4-2;1-4(5)3-6-2/h3-4H2,1-2H3;4-5H,3H2,1-2H3.
What are the key properties of 1-methoxypropan-2-ol;pentan-3-one?
1-methoxypropan-2-ol;pentan-3-one has a molecular weight of 176.26 g/mol, XLogP of 1.39, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxypropan-2-ol;pentan-3-one is sourced from PubChem (CID 89375765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).