About 2-[1-(3,4-dichloro-1,2-thiazol-5-yl)ethenylamino]benzonitrile
2-[1-(3,4-dichloro-1,2-thiazol-5-yl)ethenylamino]benzonitrile (PubChem CID 89376270) has the molecular formula C12H7Cl2N3S
and a molecular weight of 296.18 g/mol. Its IUPAC name is 2-[1-(3,4-dichloro-1,2-thiazol-5-yl)ethenylamino]benzonitrile.
Molecular Properties
| Compound Name | 2-[1-(3,4-dichloro-1,2-thiazol-5-yl)ethenylamino]benzonitrile |
| PubChem CID | 89376270 |
| Molecular Formula | C12H7Cl2N3S |
| Molecular Weight | 296.18 g/mol |
| Exact Mass | 294.97 |
| IUPAC Name | 2-[1-(3,4-dichloro-1,2-thiazol-5-yl)ethenylamino]benzonitrile |
| SMILES | C=C(Nc1ccccc1C#N)c1snc(Cl)c1Cl |
| InChI | InChI=1S/C12H7Cl2N3S/c1-7(11-10(13)12(14)17-18-11)16-9-5-3-2-4-8(9)6-15/h2-5,16H,1H2 |
| InChIKey | BGMDVOHEPXRRGH-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.18 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[1-(3,4-dichloro-1,2-thiazol-5-yl)ethenylamino]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-(3,4-dichloro-1,2-thiazol-5-yl)ethenylamino]benzonitrile?
The IUPAC name of 2-[1-(3,4-dichloro-1,2-thiazol-5-yl)ethenylamino]benzonitrile (CID 89376270) is 2-[1-(3,4-dichloro-1,2-thiazol-5-yl)ethenylamino]benzonitrile.
What is the SMILES notation for 2-[1-(3,4-dichloro-1,2-thiazol-5-yl)ethenylamino]benzonitrile?
The canonical SMILES for 2-[1-(3,4-dichloro-1,2-thiazol-5-yl)ethenylamino]benzonitrile is C=C(Nc1ccccc1C#N)c1snc(Cl)c1Cl.
What is the InChIKey of 2-[1-(3,4-dichloro-1,2-thiazol-5-yl)ethenylamino]benzonitrile?
The InChIKey is BGMDVOHEPXRRGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7Cl2N3S/c1-7(11-10(13)12(14)17-18-11)16-9-5-3-2-4-8(9)6-15/h2-5,16H,1H2.
What are the key properties of 2-[1-(3,4-dichloro-1,2-thiazol-5-yl)ethenylamino]benzonitrile?
2-[1-(3,4-dichloro-1,2-thiazol-5-yl)ethenylamino]benzonitrile has a molecular weight of 296.18 g/mol, XLogP of 4.40, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(3,4-dichloro-1,2-thiazol-5-yl)ethenylamino]benzonitrile is sourced from PubChem (CID 89376270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).