About 4a,9a-dihydroacridine
4a,9a-dihydroacridine (PubChem CID 89376300) has the molecular formula C13H11N
and a molecular weight of 181.24 g/mol. Its IUPAC name is 4a,9a-dihydroacridine.
Molecular Properties
| Compound Name | 4a,9a-dihydroacridine |
| PubChem CID | 89376300 |
| Molecular Formula | C13H11N |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | 4a,9a-dihydroacridine |
| SMILES | C1=CC2C=c3ccccc3=NC2C=C1 |
| InChI | InChI=1S/C13H11N/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)14-12/h1-10,12H |
| InChIKey | PJMIGRPUFURVPK-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4a,9a-dihydroacridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4a,9a-dihydroacridine?
The IUPAC name of 4a,9a-dihydroacridine (CID 89376300) is 4a,9a-dihydroacridine.
What is the SMILES notation for 4a,9a-dihydroacridine?
The canonical SMILES for 4a,9a-dihydroacridine is C1=CC2C=c3ccccc3=NC2C=C1.
What is the InChIKey of 4a,9a-dihydroacridine?
The InChIKey is PJMIGRPUFURVPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11N/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)14-12/h1-10,12H.
What are the key properties of 4a,9a-dihydroacridine?
4a,9a-dihydroacridine has a molecular weight of 181.24 g/mol, XLogP of 1.21, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4a,9a-dihydroacridine is sourced from PubChem (CID 89376300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).