C23H16F3N3O — CID 89376345
N-(1-imino-2,3-dihydroinden-5-yl)-2-[2-(trifluoromethyl)phenyl]furo[2,3-c]pyridin-3-amine (PubChem CID 89376345) has the molecular formula C23H16F3N3O and a molecular weight of 407.40 g/mol. Its IUPAC name is N-(1-imino-2,3-dihydroinden-5-yl)-2-[2-(trifluoromethyl)phenyl]furo[2,3-c]pyridin-3-amine.
| Compound Name | N-(1-imino-2,3-dihydroinden-5-yl)-2-[2-(trifluoromethyl)phenyl]furo[2,3-c]pyridin-3-amine |
|---|---|
| PubChem CID | 89376345 |
| Molecular Formula | C23H16F3N3O |
| Molecular Weight | 407.40 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | N-(1-imino-2,3-dihydroinden-5-yl)-2-[2-(trifluoromethyl)phenyl]furo[2,3-c]pyridin-3-amine |
| SMILES | [H]/N=C1\CCc2cc(Nc3c(-c4ccccc4C(F)(F)F)oc4cnccc34)ccc21 |
| InChI | InChI=1S/C23H16F3N3O/c24-23(25,26)18-4-2-1-3-16(18)22-21(17-9-10-28-12-20(17)30-22)29-14-6-7-15-13(11-14)5-8-19(15)27/h1-4,6-7,9-12,27,29H,5,8H2/b27-19+ |
| InChIKey | DDIBKXJWVQXMDN-ZXVVBBHZSA-N |
| XLogP | 6.57 |
| TPSA | 61.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.40 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|