About 2,3,4-triethyl-5-methylfuran
2,3,4-triethyl-5-methylfuran (PubChem CID 89376358) has the molecular formula C11H18O
and a molecular weight of 166.26 g/mol. Its IUPAC name is 2,3,4-triethyl-5-methylfuran.
Molecular Properties
| Compound Name | 2,3,4-triethyl-5-methylfuran |
| PubChem CID | 89376358 |
| Molecular Formula | C11H18O |
| Molecular Weight | 166.26 g/mol |
| Exact Mass | 166.14 |
| IUPAC Name | 2,3,4-triethyl-5-methylfuran |
| SMILES | CCc1oc(C)c(CC)c1CC |
| InChI | InChI=1S/C11H18O/c1-5-9-8(4)12-11(7-3)10(9)6-2/h5-7H2,1-4H3 |
| InChIKey | LWULCYVNSDPCGQ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.26 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,3,4-triethyl-5-methylfuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3,4-triethyl-5-methylfuran?
The IUPAC name of 2,3,4-triethyl-5-methylfuran (CID 89376358) is 2,3,4-triethyl-5-methylfuran.
What is the SMILES notation for 2,3,4-triethyl-5-methylfuran?
The canonical SMILES for 2,3,4-triethyl-5-methylfuran is CCc1oc(C)c(CC)c1CC.
What is the InChIKey of 2,3,4-triethyl-5-methylfuran?
The InChIKey is LWULCYVNSDPCGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O/c1-5-9-8(4)12-11(7-3)10(9)6-2/h5-7H2,1-4H3.
What are the key properties of 2,3,4-triethyl-5-methylfuran?
2,3,4-triethyl-5-methylfuran has a molecular weight of 166.26 g/mol, XLogP of 3.28, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,4-triethyl-5-methylfuran is sourced from PubChem (CID 89376358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).