C29H38ClIN6O3S — CID 89376615
3-chloro-5-(iodomethyl)-N-[[4-[[[4-(2-morpholin-4-ylethylamino)quinazolin-2-yl]amino]methyl]cyclohexyl]methyl]benzenesulfonamide (PubChem CID 89376615) has the molecular formula C29H38ClIN6O3S and a molecular weight of 713.09 g/mol. Its IUPAC name is 3-chloro-5-(iodomethyl)-N-[[4-[[[4-(2-morpholin-4-ylethylamino)quinazolin-2-yl]amino]methyl]cyclohexyl]methyl]benzenesulfonamide.
| Compound Name | 3-chloro-5-(iodomethyl)-N-[[4-[[[4-(2-morpholin-4-ylethylamino)quinazolin-2-yl]amino]methyl]cyclohexyl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 89376615 |
| Molecular Formula | C29H38ClIN6O3S |
| Molecular Weight | 713.09 g/mol |
| Exact Mass | 712.15 |
| IUPAC Name | 3-chloro-5-(iodomethyl)-N-[[4-[[[4-(2-morpholin-4-ylethylamino)quinazolin-2-yl]amino]methyl]cyclohexyl]methyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCC1CCC(CNc2nc(NCCN3CCOCC3)c3ccccc3n2)CC1)c1cc(Cl)cc(CI)c1 |
| InChI | InChI=1S/C29H38ClIN6O3S/c30-24-15-23(18-31)16-25(17-24)41(38,39)34-20-22-7-5-21(6-8-22)19-33-29-35-27-4-2-1-3-26(27)28(36-29)32-9-10-37-11-13-40-14-12-37/h1-4,15-17,21-22,34H,5-14,18-20H2,(H2,32,33,35,36) |
| InChIKey | IMEWTHOMWMBTRO-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 108.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.09 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|