C32H25ClN8O4S — CID 89376895
2-[4-[bis(1-cyanoethyl)amino]-2-methylphenyl]imino-N-(2-chloro-5-formamidophenyl)-2-(4-oxo-3-thiophen-3-ylfuro[2,3-d]pyrimidin-2-yl)acetamide (PubChem CID 89376895) has the molecular formula C32H25ClN8O4S and a molecular weight of 653.12 g/mol. Its IUPAC name is 2-[4-[bis(1-cyanoethyl)amino]-2-methylphenyl]imino-N-(2-chloro-5-formamidophenyl)-2-(4-oxo-3-thiophen-3-ylfuro[2,3-d]pyrimidin-2-yl)acetamide.
| Compound Name | 2-[4-[bis(1-cyanoethyl)amino]-2-methylphenyl]imino-N-(2-chloro-5-formamidophenyl)-2-(4-oxo-3-thiophen-3-ylfuro[2,3-d]pyrimidin-2-yl)acetamide |
|---|---|
| PubChem CID | 89376895 |
| Molecular Formula | C32H25ClN8O4S |
| Molecular Weight | 653.12 g/mol |
| Exact Mass | 652.14 |
| IUPAC Name | 2-[4-[bis(1-cyanoethyl)amino]-2-methylphenyl]imino-N-(2-chloro-5-formamidophenyl)-2-(4-oxo-3-thiophen-3-ylfuro[2,3-d]pyrimidin-2-yl)acetamide |
| SMILES | Cc1cc(N(C(C)C#N)C(C)C#N)ccc1/N=C(\C(=O)Nc1cc(NC=O)ccc1Cl)c1nc2occc2c(=O)n1-c1ccsc1 |
| InChI | InChI=1S/C32H25ClN8O4S/c1-18-12-22(40(19(2)14-34)20(3)15-35)5-7-26(18)37-28(30(43)38-27-13-21(36-17-42)4-6-25(27)33)29-39-31-24(8-10-45-31)32(44)41(29)23-9-11-46-16-23/h4-13,16-17,19-20H,1-3H3,(H,36,42)(H,38,43)/b37-28- |
| InChIKey | URDIOLQBWITUSD-FSUXQIQLSA-N |
| XLogP | 5.96 |
| TPSA | 169.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.12 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|