C22H20Cl2N3O2PS — CID 89376998
7-[(3,4-dichlorophenyl)methyl]-9-ethenylphosphanyloxy-5-[methyl(methylsulfanyl)amino]-6H-pyrrolo[3,4-g]quinolin-8-one (PubChem CID 89376998) has the molecular formula C22H20Cl2N3O2PS and a molecular weight of 492.37 g/mol. Its IUPAC name is 7-[(3,4-dichlorophenyl)methyl]-9-ethenylphosphanyloxy-5-[methyl(methylsulfanyl)amino]-6H-pyrrolo[3,4-g]quinolin-8-one.
| Compound Name | 7-[(3,4-dichlorophenyl)methyl]-9-ethenylphosphanyloxy-5-[methyl(methylsulfanyl)amino]-6H-pyrrolo[3,4-g]quinolin-8-one |
|---|---|
| PubChem CID | 89376998 |
| Molecular Formula | C22H20Cl2N3O2PS |
| Molecular Weight | 492.37 g/mol |
| Exact Mass | 491.04 |
| IUPAC Name | 7-[(3,4-dichlorophenyl)methyl]-9-ethenylphosphanyloxy-5-[methyl(methylsulfanyl)amino]-6H-pyrrolo[3,4-g]quinolin-8-one |
| SMILES | C=CPOc1c2c(c(N(C)SC)c3cccnc13)CN(Cc1ccc(Cl)c(Cl)c1)C2=O |
| InChI | InChI=1S/C22H20Cl2N3O2PS/c1-4-30-29-21-18-15(20(26(2)31-3)14-6-5-9-25-19(14)21)12-27(22(18)28)11-13-7-8-16(23)17(24)10-13/h4-10,30H,1,11-12H2,2-3H3 |
| InChIKey | MGPJGEGXUXRPNI-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.37 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|