C42H23NO4 — CID 89377060
20,22-diacetyl-7-phenyl-7-azanonacyclo[14.12.2.22,5.117,21.03,12.04,9.013,29.026,30.025,31]tritriaconta-1(29),2,4,9,11,13,15,17,19,21,23,25(31),26(30),27,32-pentadecaene-6,8-dione (PubChem CID 89377060) has the molecular formula C42H23NO4 and a molecular weight of 605.65 g/mol. Its IUPAC name is 20,22-diacetyl-7-phenyl-7-azanonacyclo[14.12.2.22,5.117,21.03,12.04,9.013,29.026,30.025,31]tritriaconta-1(29),2,4,9,11,13,15,17,19,21,23,25(31),26(30),27,32-pentadecaene-6,8-dione.
| Compound Name | 20,22-diacetyl-7-phenyl-7-azanonacyclo[14.12.2.22,5.117,21.03,12.04,9.013,29.026,30.025,31]tritriaconta-1(29),2,4,9,11,13,15,17,19,21,23,25(31),26(30),27,32-pentadecaene-6,8-dione |
|---|---|
| PubChem CID | 89377060 |
| Molecular Formula | C42H23NO4 |
| Molecular Weight | 605.65 g/mol |
| Exact Mass | 605.16 |
| IUPAC Name | 20,22-diacetyl-7-phenyl-7-azanonacyclo[14.12.2.22,5.117,21.03,12.04,9.013,29.026,30.025,31]tritriaconta-1(29),2,4,9,11,13,15,17,19,21,23,25(31),26(30),27,32-pentadecaene-6,8-dione |
| SMILES | CC(=O)c1ccc2c3ccc4c5ccc6c7c(ccc(c8ccc(c9ccc(C(C)=O)c1c29)c3c48)c75)C(=O)N(c1ccccc1)C6=O |
| InChI | InChI=1S/C42H23NO4/c1-20(44)23-8-10-25-27-12-14-29-31-16-18-33-40-34(42(47)43(41(33)46)22-6-4-3-5-7-22)19-17-32(39(31)40)30-15-13-28(37(27)38(29)30)26-11-9-24(21(2)45)35(23)36(25)26/h3-19H,1-2H3 |
| InChIKey | PTMAMYGBNNGOCS-UHFFFAOYSA-N |
| XLogP | 9.84 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.65 |
| LogP ≤ 5 | 9.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|