About 7-O-tert-butyl 1-O-methyl (2S,4S)-2-methyl-6-methylidene-4-propan-2-yloxyheptanedioate
7-O-tert-butyl 1-O-methyl (2S,4S)-2-methyl-6-methylidene-4-propan-2-yloxyheptanedioate (PubChem CID 89377447) has the molecular formula C17H30O5
and a molecular weight of 314.42 g/mol. Its IUPAC name is 7-O-tert-butyl 1-O-methyl (2S,4S)-2-methyl-6-methylidene-4-propan-2-yloxyheptanedioate.
Molecular Properties
| Compound Name | 7-O-tert-butyl 1-O-methyl (2S,4S)-2-methyl-6-methylidene-4-propan-2-yloxyheptanedioate |
| PubChem CID | 89377447 |
| Molecular Formula | C17H30O5 |
| Molecular Weight | 314.42 g/mol |
| Exact Mass | 314.21 |
| IUPAC Name | 7-O-tert-butyl 1-O-methyl (2S,4S)-2-methyl-6-methylidene-4-propan-2-yloxyheptanedioate |
| SMILES | C=C(C[C@H](C[C@H](C)C(=O)OC)OC(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H30O5/c1-11(2)21-14(9-12(3)15(18)20-8)10-13(4)16(19)22-17(5,6)7/h11-12,14H,4,9-10H2,1-3,5-8H3/t12-,14-/m0/s1 |
| InChIKey | PXHDWSOYQMSWBR-JSGCOSHPSA-N |
| XLogP | 3.27 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.42 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 7-O-tert-butyl 1-O-methyl (2S,4S)-2-methyl-6-methylidene-4-propan-2-yloxyheptanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-O-tert-butyl 1-O-methyl (2S,4S)-2-methyl-6-methylidene-4-propan-2-yloxyheptanedioate?
The IUPAC name of 7-O-tert-butyl 1-O-methyl (2S,4S)-2-methyl-6-methylidene-4-propan-2-yloxyheptanedioate (CID 89377447) is 7-O-tert-butyl 1-O-methyl (2S,4S)-2-methyl-6-methylidene-4-propan-2-yloxyheptanedioate.
What is the SMILES notation for 7-O-tert-butyl 1-O-methyl (2S,4S)-2-methyl-6-methylidene-4-propan-2-yloxyheptanedioate?
The canonical SMILES for 7-O-tert-butyl 1-O-methyl (2S,4S)-2-methyl-6-methylidene-4-propan-2-yloxyheptanedioate is C=C(C[C@H](C[C@H](C)C(=O)OC)OC(C)C)C(=O)OC(C)(C)C.
What is the InChIKey of 7-O-tert-butyl 1-O-methyl (2S,4S)-2-methyl-6-methylidene-4-propan-2-yloxyheptanedioate?
The InChIKey is PXHDWSOYQMSWBR-JSGCOSHPSA-N. The full InChI is InChI=1S/C17H30O5/c1-11(2)21-14(9-12(3)15(18)20-8)10-13(4)16(19)22-17(5,6)7/h11-12,14H,4,9-10H2,1-3,5-8H3/t12-,14-/m0/s1.
What are the key properties of 7-O-tert-butyl 1-O-methyl (2S,4S)-2-methyl-6-methylidene-4-propan-2-yloxyheptanedioate?
7-O-tert-butyl 1-O-methyl (2S,4S)-2-methyl-6-methylidene-4-propan-2-yloxyheptanedioate has a molecular weight of 314.42 g/mol, XLogP of 3.27, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-O-tert-butyl 1-O-methyl (2S,4S)-2-methyl-6-methylidene-4-propan-2-yloxyheptanedioate is sourced from PubChem (CID 89377447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).