C30H24N2S4 — CID 89377813
2-[4,10-bis(3-methyl-4,5,6,7-tetrahydro-2-benzothiophen-1-yl)-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-7-ylidene]propanedinitrile (PubChem CID 89377813) has the molecular formula C30H24N2S4 and a molecular weight of 540.80 g/mol. Its IUPAC name is 2-[4,10-bis(3-methyl-4,5,6,7-tetrahydro-2-benzothiophen-1-yl)-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-7-ylidene]propanedinitrile.
| Compound Name | 2-[4,10-bis(3-methyl-4,5,6,7-tetrahydro-2-benzothiophen-1-yl)-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-7-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 89377813 |
| Molecular Formula | C30H24N2S4 |
| Molecular Weight | 540.80 g/mol |
| Exact Mass | 540.08 |
| IUPAC Name | 2-[4,10-bis(3-methyl-4,5,6,7-tetrahydro-2-benzothiophen-1-yl)-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-7-ylidene]propanedinitrile |
| SMILES | Cc1sc(-c2cc3c(s2)-c2sc(-c4sc(C)c5c4CCCC5)cc2C3=C(C#N)C#N)c2c1CCCC2 |
| InChI | InChI=1S/C30H24N2S4/c1-15-18-7-3-5-9-20(18)27(33-15)24-11-22-26(17(13-31)14-32)23-12-25(36-30(23)29(22)35-24)28-21-10-6-4-8-19(21)16(2)34-28/h11-12H,3-10H2,1-2H3 |
| InChIKey | SAPCUYCKNDLTHR-UHFFFAOYSA-N |
| XLogP | 9.47 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.80 |
| LogP ≤ 5 | 9.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|