C9H17N — CID 89377891
(2S,4Z)-2,5-dimethylhepta-4,6-dien-1-amine (PubChem CID 89377891) has the molecular formula C9H17N and a molecular weight of 139.24 g/mol. Its IUPAC name is (2S,4Z)-2,5-dimethylhepta-4,6-dien-1-amine.
| Compound Name | (2S,4Z)-2,5-dimethylhepta-4,6-dien-1-amine |
|---|---|
| PubChem CID | 89377891 |
| Molecular Formula | C9H17N |
| Molecular Weight | 139.24 g/mol |
| Exact Mass | 139.14 |
| IUPAC Name | (2S,4Z)-2,5-dimethylhepta-4,6-dien-1-amine |
| SMILES | C=C/C(C)=C\C[C@H](C)CN |
| InChI | InChI=1S/C9H17N/c1-4-8(2)5-6-9(3)7-10/h4-5,9H,1,6-7,10H2,2-3H3/b8-5-/t9-/m0/s1 |
| InChIKey | OJJVJABVEWAHAE-RDOCRHDPSA-N |
| XLogP | 2.10 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.24 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|