C27H22F6N4O — CID 89377927
5-[3,5-bis(trifluoromethyl)phenyl]-7,7,11-trimethyl-5,11,14,15-tetrazapentacyclo[10.8.0.02,10.04,8.013,17]icosa-1(12),2,4(8),9,13(17),15-hexaen-6-one (PubChem CID 89377927) has the molecular formula C27H22F6N4O and a molecular weight of 532.49 g/mol. Its IUPAC name is 5-[3,5-bis(trifluoromethyl)phenyl]-7,7,11-trimethyl-5,11,14,15-tetrazapentacyclo[10.8.0.02,10.04,8.013,17]icosa-1(12),2,4(8),9,13(17),15-hexaen-6-one.
| Compound Name | 5-[3,5-bis(trifluoromethyl)phenyl]-7,7,11-trimethyl-5,11,14,15-tetrazapentacyclo[10.8.0.02,10.04,8.013,17]icosa-1(12),2,4(8),9,13(17),15-hexaen-6-one |
|---|---|
| PubChem CID | 89377927 |
| Molecular Formula | C27H22F6N4O |
| Molecular Weight | 532.49 g/mol |
| Exact Mass | 532.17 |
| IUPAC Name | 5-[3,5-bis(trifluoromethyl)phenyl]-7,7,11-trimethyl-5,11,14,15-tetrazapentacyclo[10.8.0.02,10.04,8.013,17]icosa-1(12),2,4(8),9,13(17),15-hexaen-6-one |
| SMILES | Cn1c2c(c3cc4c(cc31)C(C)(C)C(=O)N4c1cc(C(F)(F)F)cc(C(F)(F)F)c1)CCCc1cn[nH]c1-2 |
| InChI | InChI=1S/C27H22F6N4O/c1-25(2)19-11-20-18(17-6-4-5-13-12-34-35-22(13)23(17)36(20)3)10-21(19)37(24(25)38)16-8-14(26(28,29)30)7-15(9-16)27(31,32)33/h7-12H,4-6H2,1-3H3,(H,34,35) |
| InChIKey | ARJVMCIBHKTESE-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 53.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.49 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|