About 4-(4-fluorophenyl)-3,3-dimethyloct-7-en-4-ol
4-(4-fluorophenyl)-3,3-dimethyloct-7-en-4-ol (PubChem CID 89377990) has the molecular formula C16H23FO
and a molecular weight of 250.36 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-3,3-dimethyloct-7-en-4-ol.
Molecular Properties
| Compound Name | 4-(4-fluorophenyl)-3,3-dimethyloct-7-en-4-ol |
| PubChem CID | 89377990 |
| Molecular Formula | C16H23FO |
| Molecular Weight | 250.36 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | 4-(4-fluorophenyl)-3,3-dimethyloct-7-en-4-ol |
| SMILES | C=CCCC(O)(c1ccc(F)cc1)C(C)(C)CC |
| InChI | InChI=1S/C16H23FO/c1-5-7-12-16(18,15(3,4)6-2)13-8-10-14(17)11-9-13/h5,8-11,18H,1,6-7,12H2,2-4H3 |
| InChIKey | HDOHOKVKGWNUBI-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.36 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-fluorophenyl)-3,3-dimethyloct-7-en-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-fluorophenyl)-3,3-dimethyloct-7-en-4-ol?
The IUPAC name of 4-(4-fluorophenyl)-3,3-dimethyloct-7-en-4-ol (CID 89377990) is 4-(4-fluorophenyl)-3,3-dimethyloct-7-en-4-ol.
What is the SMILES notation for 4-(4-fluorophenyl)-3,3-dimethyloct-7-en-4-ol?
The canonical SMILES for 4-(4-fluorophenyl)-3,3-dimethyloct-7-en-4-ol is C=CCCC(O)(c1ccc(F)cc1)C(C)(C)CC.
What is the InChIKey of 4-(4-fluorophenyl)-3,3-dimethyloct-7-en-4-ol?
The InChIKey is HDOHOKVKGWNUBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23FO/c1-5-7-12-16(18,15(3,4)6-2)13-8-10-14(17)11-9-13/h5,8-11,18H,1,6-7,12H2,2-4H3.
What are the key properties of 4-(4-fluorophenyl)-3,3-dimethyloct-7-en-4-ol?
4-(4-fluorophenyl)-3,3-dimethyloct-7-en-4-ol has a molecular weight of 250.36 g/mol, XLogP of 4.42, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-fluorophenyl)-3,3-dimethyloct-7-en-4-ol is sourced from PubChem (CID 89377990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).