C19H19F2N — CID 89378353
(2Z,4Z,6E,8E)-9-fluoro-1-(4-fluorophenyl)-N,6-dimethylundeca-2,4,6,8,10-pentaen-1-imine (PubChem CID 89378353) has the molecular formula C19H19F2N and a molecular weight of 299.36 g/mol. Its IUPAC name is (2Z,4Z,6E,8E)-9-fluoro-1-(4-fluorophenyl)-N,6-dimethylundeca-2,4,6,8,10-pentaen-1-imine.
| Compound Name | (2Z,4Z,6E,8E)-9-fluoro-1-(4-fluorophenyl)-N,6-dimethylundeca-2,4,6,8,10-pentaen-1-imine |
|---|---|
| PubChem CID | 89378353 |
| Molecular Formula | C19H19F2N |
| Molecular Weight | 299.36 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | (2Z,4Z,6E,8E)-9-fluoro-1-(4-fluorophenyl)-N,6-dimethylundeca-2,4,6,8,10-pentaen-1-imine |
| SMILES | C=C/C(F)=C\C=C(C)\C=C/C=C\C(=N\C)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H19F2N/c1-4-17(20)12-9-15(2)7-5-6-8-19(22-3)16-10-13-18(21)14-11-16/h4-14H,1H2,2-3H3/b7-5-,8-6-,15-9+,17-12+,22-19- |
| InChIKey | MKKFJLMJYRHUJW-WRVSGPIQSA-N |
| XLogP | 5.34 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.36 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|