About 5-[3,5-bis(trifluoromethyl)phenyl]-2-propoxybenzamide
5-[3,5-bis(trifluoromethyl)phenyl]-2-propoxybenzamide (PubChem CID 89378570) has the molecular formula C18H15F6NO2
and a molecular weight of 391.31 g/mol. Its IUPAC name is 5-[3,5-bis(trifluoromethyl)phenyl]-2-propoxybenzamide.
Molecular Properties
| Compound Name | 5-[3,5-bis(trifluoromethyl)phenyl]-2-propoxybenzamide |
| PubChem CID | 89378570 |
| Molecular Formula | C18H15F6NO2 |
| Molecular Weight | 391.31 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | 5-[3,5-bis(trifluoromethyl)phenyl]-2-propoxybenzamide |
| SMILES | CCCOc1ccc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc1C(N)=O |
| InChI | InChI=1S/C18H15F6NO2/c1-2-5-27-15-4-3-10(8-14(15)16(25)26)11-6-12(17(19,20)21)9-13(7-11)18(22,23)24/h3-4,6-9H,2,5H2,1H3,(H2,25,26) |
| InChIKey | MBSFLHNZKPBJNU-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 391.31 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-[3,5-bis(trifluoromethyl)phenyl]-2-propoxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[3,5-bis(trifluoromethyl)phenyl]-2-propoxybenzamide?
The IUPAC name of 5-[3,5-bis(trifluoromethyl)phenyl]-2-propoxybenzamide (CID 89378570) is 5-[3,5-bis(trifluoromethyl)phenyl]-2-propoxybenzamide.
What is the SMILES notation for 5-[3,5-bis(trifluoromethyl)phenyl]-2-propoxybenzamide?
The canonical SMILES for 5-[3,5-bis(trifluoromethyl)phenyl]-2-propoxybenzamide is CCCOc1ccc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc1C(N)=O.
What is the InChIKey of 5-[3,5-bis(trifluoromethyl)phenyl]-2-propoxybenzamide?
The InChIKey is MBSFLHNZKPBJNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15F6NO2/c1-2-5-27-15-4-3-10(8-14(15)16(25)26)11-6-12(17(19,20)21)9-13(7-11)18(22,23)24/h3-4,6-9H,2,5H2,1H3,(H2,25,26).
What are the key properties of 5-[3,5-bis(trifluoromethyl)phenyl]-2-propoxybenzamide?
5-[3,5-bis(trifluoromethyl)phenyl]-2-propoxybenzamide has a molecular weight of 391.31 g/mol, XLogP of 5.28, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[3,5-bis(trifluoromethyl)phenyl]-2-propoxybenzamide is sourced from PubChem (CID 89378570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).