C10H11N — CID 89378692
1,2,3,4-tetrahydrocyclohepta[b]pyridine (PubChem CID 89378692) has the molecular formula C10H11N and a molecular weight of 145.20 g/mol. Its IUPAC name is 1,2,3,4-tetrahydrocyclohepta[b]pyridine.
| Compound Name | 1,2,3,4-tetrahydrocyclohepta[b]pyridine |
|---|---|
| PubChem CID | 89378692 |
| Molecular Formula | C10H11N |
| Molecular Weight | 145.20 g/mol |
| Exact Mass | 145.09 |
| IUPAC Name | 1,2,3,4-tetrahydrocyclohepta[b]pyridine |
| SMILES | C1=CC=C2CCCNC2=CC=1 |
| InChI | InChI=1S/C10H11N/c1-2-5-9-6-4-8-11-10(9)7-3-1/h2-3,5,7,11H,4,6,8H2 |
| InChIKey | OLVYJRNKNAPIHZ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.20 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |