C18H24FN3 — CID 89378819
N'-[5-[1-(4-fluorophenyl)ethenyl]-1,2,3,6-tetrahydropyridin-4-yl]-2-methylbutanimidamide (PubChem CID 89378819) has the molecular formula C18H24FN3 and a molecular weight of 301.41 g/mol. Its IUPAC name is N'-[5-[1-(4-fluorophenyl)ethenyl]-1,2,3,6-tetrahydropyridin-4-yl]-2-methylbutanimidamide.
| Compound Name | N'-[5-[1-(4-fluorophenyl)ethenyl]-1,2,3,6-tetrahydropyridin-4-yl]-2-methylbutanimidamide |
|---|---|
| PubChem CID | 89378819 |
| Molecular Formula | C18H24FN3 |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.20 |
| IUPAC Name | N'-[5-[1-(4-fluorophenyl)ethenyl]-1,2,3,6-tetrahydropyridin-4-yl]-2-methylbutanimidamide |
| SMILES | C=C(C1=C(/N=C(\N)C(C)CC)CCNC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H24FN3/c1-4-12(2)18(20)22-17-9-10-21-11-16(17)13(3)14-5-7-15(19)8-6-14/h5-8,12,21H,3-4,9-11H2,1-2H3,(H2,20,22) |
| InChIKey | DZTODFATCRASGQ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|