C10H9ClF2N4 — CID 89378903
5-[(1E,3E)-1-amino-2,4-difluorohexa-1,3,5-trien-3-yl]-6-chloropyrazin-2-amine (PubChem CID 89378903) has the molecular formula C10H9ClF2N4 and a molecular weight of 258.66 g/mol. Its IUPAC name is 5-[(1E,3E)-1-amino-2,4-difluorohexa-1,3,5-trien-3-yl]-6-chloropyrazin-2-amine.
| Compound Name | 5-[(1E,3E)-1-amino-2,4-difluorohexa-1,3,5-trien-3-yl]-6-chloropyrazin-2-amine |
|---|---|
| PubChem CID | 89378903 |
| Molecular Formula | C10H9ClF2N4 |
| Molecular Weight | 258.66 g/mol |
| Exact Mass | 258.05 |
| IUPAC Name | 5-[(1E,3E)-1-amino-2,4-difluorohexa-1,3,5-trien-3-yl]-6-chloropyrazin-2-amine |
| SMILES | C=C/C(F)=C(C(\F)=C/N)/c1ncc(N)nc1Cl |
| InChI | InChI=1S/C10H9ClF2N4/c1-2-5(12)8(6(13)3-14)9-10(11)17-7(15)4-16-9/h2-4H,1,14H2,(H2,15,17)/b6-3+,8-5- |
| InChIKey | QFANSVKNXOKKBU-DRZGJBBASA-N |
| XLogP | 2.35 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.66 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|