About 2-(ethylideneamino)-N'-(methyliminomethyl)prop-2-enimidamide
2-(ethylideneamino)-N'-(methyliminomethyl)prop-2-enimidamide (PubChem CID 89378957) has the molecular formula C7H12N4
and a molecular weight of 152.20 g/mol. Its IUPAC name is 2-(ethylideneamino)-N'-(methyliminomethyl)prop-2-enimidamide.
Molecular Properties
| Compound Name | 2-(ethylideneamino)-N'-(methyliminomethyl)prop-2-enimidamide |
| PubChem CID | 89378957 |
| Molecular Formula | C7H12N4 |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.11 |
| IUPAC Name | 2-(ethylideneamino)-N'-(methyliminomethyl)prop-2-enimidamide |
| SMILES | C=C(/N=C/C)/C(N)=N\C=N\C |
| InChI | InChI=1S/C7H12N4/c1-4-10-6(2)7(8)11-5-9-3/h4-5H,2H2,1,3H3,(H2,8,9,11)/b10-4+ |
| InChIKey | MEZHMTSAKJHXIH-ONNFQVAWSA-N |
| XLogP | 0.61 |
| TPSA | 63.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(ethylideneamino)-N'-(methyliminomethyl)prop-2-enimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(ethylideneamino)-N'-(methyliminomethyl)prop-2-enimidamide?
The IUPAC name of 2-(ethylideneamino)-N'-(methyliminomethyl)prop-2-enimidamide (CID 89378957) is 2-(ethylideneamino)-N'-(methyliminomethyl)prop-2-enimidamide.
What is the SMILES notation for 2-(ethylideneamino)-N'-(methyliminomethyl)prop-2-enimidamide?
The canonical SMILES for 2-(ethylideneamino)-N'-(methyliminomethyl)prop-2-enimidamide is C=C(/N=C/C)/C(N)=N\C=N\C.
What is the InChIKey of 2-(ethylideneamino)-N'-(methyliminomethyl)prop-2-enimidamide?
The InChIKey is MEZHMTSAKJHXIH-ONNFQVAWSA-N. The full InChI is InChI=1S/C7H12N4/c1-4-10-6(2)7(8)11-5-9-3/h4-5H,2H2,1,3H3,(H2,8,9,11)/b10-4+.
What are the key properties of 2-(ethylideneamino)-N'-(methyliminomethyl)prop-2-enimidamide?
2-(ethylideneamino)-N'-(methyliminomethyl)prop-2-enimidamide has a molecular weight of 152.20 g/mol, XLogP of 0.61, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(ethylideneamino)-N'-(methyliminomethyl)prop-2-enimidamide is sourced from PubChem (CID 89378957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).