C22H34O5 — CID 89379571
(2S,3R,6R)-2-[(1S)-1-methoxyprop-2-enyl]-6-[[(2S,3R,6R)-2-[(1S)-1-methoxyprop-2-enyl]-3,5-dimethyl-3,6-dihydro-2H-pyran-6-yl]oxy]-3,5-dimethyl-3,6-dihydro-2H-pyran (PubChem CID 89379571) has the molecular formula C22H34O5 and a molecular weight of 378.51 g/mol. Its IUPAC name is (2S,3R,6R)-2-[(1S)-1-methoxyprop-2-enyl]-6-[[(2S,3R,6R)-2-[(1S)-1-methoxyprop-2-enyl]-3,5-dimethyl-3,6-dihydro-2H-pyran-6-yl]oxy]-3,5-dimethyl-3,6-dihydro-2H-pyran.
| Compound Name | (2S,3R,6R)-2-[(1S)-1-methoxyprop-2-enyl]-6-[[(2S,3R,6R)-2-[(1S)-1-methoxyprop-2-enyl]-3,5-dimethyl-3,6-dihydro-2H-pyran-6-yl]oxy]-3,5-dimethyl-3,6-dihydro-2H-pyran |
|---|---|
| PubChem CID | 89379571 |
| Molecular Formula | C22H34O5 |
| Molecular Weight | 378.51 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | (2S,3R,6R)-2-[(1S)-1-methoxyprop-2-enyl]-6-[[(2S,3R,6R)-2-[(1S)-1-methoxyprop-2-enyl]-3,5-dimethyl-3,6-dihydro-2H-pyran-6-yl]oxy]-3,5-dimethyl-3,6-dihydro-2H-pyran |
| SMILES | C=C[C@H](OC)[C@H]1O[C@H](O[C@H]2O[C@H]([C@H](C=C)OC)[C@H](C)C=C2C)C(C)=C[C@H]1C |
| InChI | InChI=1S/C22H34O5/c1-9-17(23-7)19-13(3)11-15(5)21(25-19)27-22-16(6)12-14(4)20(26-22)18(10-2)24-8/h9-14,17-22H,1-2H2,3-8H3/t13-,14-,17+,18+,19+,20+,21-,22-/m1/s1 |
| InChIKey | DSKHSXWYHFAEQZ-VQOXFBBASA-N |
| XLogP | 4.02 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.51 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|