C13H20NO4+ — CID 89379716
5,5-dimethyl-1,9-dioxa-5-azoniacyclotetradeca-11,12-diene-10,14-dione (PubChem CID 89379716) has the molecular formula C13H20NO4+ and a molecular weight of 254.31 g/mol. Its IUPAC name is 5,5-dimethyl-1,9-dioxa-5-azoniacyclotetradeca-11,12-diene-10,14-dione.
| Compound Name | 5,5-dimethyl-1,9-dioxa-5-azoniacyclotetradeca-11,12-diene-10,14-dione |
|---|---|
| PubChem CID | 89379716 |
| Molecular Formula | C13H20NO4+ |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | 5,5-dimethyl-1,9-dioxa-5-azoniacyclotetradeca-11,12-diene-10,14-dione |
| SMILES | C[N+]1(C)CCCOC(=O)C=C=CC(=O)OCCC1 |
| InChI | InChI=1S/C13H20NO4/c1-14(2)8-4-10-17-12(15)6-3-7-13(16)18-11-5-9-14/h6-7H,4-5,8-11H2,1-2H3/q+1 |
| InChIKey | NVCHLFMMHVHXTB-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|