About 3-ethenyl-1,2,5-trimethylindole
3-ethenyl-1,2,5-trimethylindole (PubChem CID 89379856) has the molecular formula C13H15N
and a molecular weight of 185.27 g/mol. Its IUPAC name is 3-ethenyl-1,2,5-trimethylindole.
Molecular Properties
| Compound Name | 3-ethenyl-1,2,5-trimethylindole |
| PubChem CID | 89379856 |
| Molecular Formula | C13H15N |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | 3-ethenyl-1,2,5-trimethylindole |
| SMILES | C=Cc1c(C)n(C)c2ccc(C)cc12 |
| InChI | InChI=1S/C13H15N/c1-5-11-10(3)14(4)13-7-6-9(2)8-12(11)13/h5-8H,1H2,2-4H3 |
| InChIKey | MFKHNZXHZXDMKK-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-ethenyl-1,2,5-trimethylindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethenyl-1,2,5-trimethylindole?
The IUPAC name of 3-ethenyl-1,2,5-trimethylindole (CID 89379856) is 3-ethenyl-1,2,5-trimethylindole.
What is the SMILES notation for 3-ethenyl-1,2,5-trimethylindole?
The canonical SMILES for 3-ethenyl-1,2,5-trimethylindole is C=Cc1c(C)n(C)c2ccc(C)cc12.
What is the InChIKey of 3-ethenyl-1,2,5-trimethylindole?
The InChIKey is MFKHNZXHZXDMKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15N/c1-5-11-10(3)14(4)13-7-6-9(2)8-12(11)13/h5-8H,1H2,2-4H3.
What are the key properties of 3-ethenyl-1,2,5-trimethylindole?
3-ethenyl-1,2,5-trimethylindole has a molecular weight of 185.27 g/mol, XLogP of 3.44, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethenyl-1,2,5-trimethylindole is sourced from PubChem (CID 89379856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).