About 2-tert-butyl-4-methyl-1,2,4-oxadiazolidine-3,5-dione
2-tert-butyl-4-methyl-1,2,4-oxadiazolidine-3,5-dione (PubChem CID 89379866) has the molecular formula C7H12N2O3
and a molecular weight of 172.18 g/mol. Its IUPAC name is 2-tert-butyl-4-methyl-1,2,4-oxadiazolidine-3,5-dione.
Molecular Properties
| Compound Name | 2-tert-butyl-4-methyl-1,2,4-oxadiazolidine-3,5-dione |
| PubChem CID | 89379866 |
| Molecular Formula | C7H12N2O3 |
| Molecular Weight | 172.18 g/mol |
| Exact Mass | 172.08 |
| IUPAC Name | 2-tert-butyl-4-methyl-1,2,4-oxadiazolidine-3,5-dione |
| SMILES | Cn1c(=O)on(C(C)(C)C)c1=O |
| InChI | InChI=1S/C7H12N2O3/c1-7(2,3)9-5(10)8(4)6(11)12-9/h1-4H3 |
| InChIKey | SDGNZRDGMVGDGZ-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 57.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.18 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-tert-butyl-4-methyl-1,2,4-oxadiazolidine-3,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-4-methyl-1,2,4-oxadiazolidine-3,5-dione?
The IUPAC name of 2-tert-butyl-4-methyl-1,2,4-oxadiazolidine-3,5-dione (CID 89379866) is 2-tert-butyl-4-methyl-1,2,4-oxadiazolidine-3,5-dione.
What is the SMILES notation for 2-tert-butyl-4-methyl-1,2,4-oxadiazolidine-3,5-dione?
The canonical SMILES for 2-tert-butyl-4-methyl-1,2,4-oxadiazolidine-3,5-dione is Cn1c(=O)on(C(C)(C)C)c1=O.
What is the InChIKey of 2-tert-butyl-4-methyl-1,2,4-oxadiazolidine-3,5-dione?
The InChIKey is SDGNZRDGMVGDGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2O3/c1-7(2,3)9-5(10)8(4)6(11)12-9/h1-4H3.
What are the key properties of 2-tert-butyl-4-methyl-1,2,4-oxadiazolidine-3,5-dione?
2-tert-butyl-4-methyl-1,2,4-oxadiazolidine-3,5-dione has a molecular weight of 172.18 g/mol, XLogP of -0.10, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-4-methyl-1,2,4-oxadiazolidine-3,5-dione is sourced from PubChem (CID 89379866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).