About (3S)-3-acetyl-6,10-dioxa-2-azaspiro[4.5]decane-2-carbaldehyde
(3S)-3-acetyl-6,10-dioxa-2-azaspiro[4.5]decane-2-carbaldehyde (PubChem CID 89380119) has the molecular formula C10H15NO4
and a molecular weight of 213.23 g/mol. Its IUPAC name is (3S)-3-acetyl-6,10-dioxa-2-azaspiro[4.5]decane-2-carbaldehyde.
Molecular Properties
| Compound Name | (3S)-3-acetyl-6,10-dioxa-2-azaspiro[4.5]decane-2-carbaldehyde |
| PubChem CID | 89380119 |
| Molecular Formula | C10H15NO4 |
| Molecular Weight | 213.23 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | (3S)-3-acetyl-6,10-dioxa-2-azaspiro[4.5]decane-2-carbaldehyde |
| SMILES | CC(=O)[C@@H]1CC2(CN1C=O)OCCCO2 |
| InChI | InChI=1S/C10H15NO4/c1-8(13)9-5-10(6-11(9)7-12)14-3-2-4-15-10/h7,9H,2-6H2,1H3/t9-/m0/s1 |
| InChIKey | OXTMJXYBJYQUFY-VIFPVBQESA-N |
| XLogP | -0.06 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.23 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (3S)-3-acetyl-6,10-dioxa-2-azaspiro[4.5]decane-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-acetyl-6,10-dioxa-2-azaspiro[4.5]decane-2-carbaldehyde?
The IUPAC name of (3S)-3-acetyl-6,10-dioxa-2-azaspiro[4.5]decane-2-carbaldehyde (CID 89380119) is (3S)-3-acetyl-6,10-dioxa-2-azaspiro[4.5]decane-2-carbaldehyde.
What is the SMILES notation for (3S)-3-acetyl-6,10-dioxa-2-azaspiro[4.5]decane-2-carbaldehyde?
The canonical SMILES for (3S)-3-acetyl-6,10-dioxa-2-azaspiro[4.5]decane-2-carbaldehyde is CC(=O)[C@@H]1CC2(CN1C=O)OCCCO2.
What is the InChIKey of (3S)-3-acetyl-6,10-dioxa-2-azaspiro[4.5]decane-2-carbaldehyde?
The InChIKey is OXTMJXYBJYQUFY-VIFPVBQESA-N. The full InChI is InChI=1S/C10H15NO4/c1-8(13)9-5-10(6-11(9)7-12)14-3-2-4-15-10/h7,9H,2-6H2,1H3/t9-/m0/s1.
What are the key properties of (3S)-3-acetyl-6,10-dioxa-2-azaspiro[4.5]decane-2-carbaldehyde?
(3S)-3-acetyl-6,10-dioxa-2-azaspiro[4.5]decane-2-carbaldehyde has a molecular weight of 213.23 g/mol, XLogP of -0.06, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-acetyl-6,10-dioxa-2-azaspiro[4.5]decane-2-carbaldehyde is sourced from PubChem (CID 89380119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).