C27H29N3O4S — CID 89380470
(4R)-3-[1-[[6-(3,4-dihydroxyphenoxy)-2-methyl-3-pyridinyl]methyl]piperidin-4-yl]-4-phenyl-1,3-oxazolidine-2-thione (PubChem CID 89380470) has the molecular formula C27H29N3O4S and a molecular weight of 491.61 g/mol. Its IUPAC name is (4R)-3-[1-[[6-(3,4-dihydroxyphenoxy)-2-methyl-3-pyridinyl]methyl]piperidin-4-yl]-4-phenyl-1,3-oxazolidine-2-thione.
| Compound Name | (4R)-3-[1-[[6-(3,4-dihydroxyphenoxy)-2-methyl-3-pyridinyl]methyl]piperidin-4-yl]-4-phenyl-1,3-oxazolidine-2-thione |
|---|---|
| PubChem CID | 89380470 |
| Molecular Formula | C27H29N3O4S |
| Molecular Weight | 491.61 g/mol |
| Exact Mass | 491.19 |
| IUPAC Name | (4R)-3-[1-[[6-(3,4-dihydroxyphenoxy)-2-methyl-3-pyridinyl]methyl]piperidin-4-yl]-4-phenyl-1,3-oxazolidine-2-thione |
| SMILES | Cc1nc(Oc2ccc(O)c(O)c2)ccc1CN1CCC(N2C(=S)OC[C@H]2c2ccccc2)CC1 |
| InChI | InChI=1S/C27H29N3O4S/c1-18-20(7-10-26(28-18)34-22-8-9-24(31)25(32)15-22)16-29-13-11-21(12-14-29)30-23(17-33-27(30)35)19-5-3-2-4-6-19/h2-10,15,21,23,31-32H,11-14,16-17H2,1H3/t23-/m0/s1 |
| InChIKey | UEQCLEPGFZXGDF-QHCPKHFHSA-N |
| XLogP | 4.92 |
| TPSA | 78.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.61 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|