C11H20O2 — CID 89380514
(3R,4R,5E)-7-ethoxy-4-methylocta-5,7-dien-3-ol (PubChem CID 89380514) has the molecular formula C11H20O2 and a molecular weight of 184.28 g/mol. Its IUPAC name is (3R,4R,5E)-7-ethoxy-4-methylocta-5,7-dien-3-ol.
| Compound Name | (3R,4R,5E)-7-ethoxy-4-methylocta-5,7-dien-3-ol |
|---|---|
| PubChem CID | 89380514 |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.15 |
| IUPAC Name | (3R,4R,5E)-7-ethoxy-4-methylocta-5,7-dien-3-ol |
| SMILES | C=C(/C=C/[C@@H](C)[C@H](O)CC)OCC |
| InChI | InChI=1S/C11H20O2/c1-5-11(12)9(3)7-8-10(4)13-6-2/h7-9,11-12H,4-6H2,1-3H3/b8-7+/t9-,11-/m1/s1 |
| InChIKey | LLDVGANTLJZWHS-FQZVFUSHSA-N |
| XLogP | 2.50 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|