About methyl 4-hydroxycyclohexa-1,3-diene-1-carboxylate
methyl 4-hydroxycyclohexa-1,3-diene-1-carboxylate (PubChem CID 89380670) has the molecular formula C8H10O3
and a molecular weight of 154.16 g/mol. Its IUPAC name is methyl 4-hydroxycyclohexa-1,3-diene-1-carboxylate.
Molecular Properties
| Compound Name | methyl 4-hydroxycyclohexa-1,3-diene-1-carboxylate |
| PubChem CID | 89380670 |
| Molecular Formula | C8H10O3 |
| Molecular Weight | 154.16 g/mol |
| Exact Mass | 154.06 |
| IUPAC Name | methyl 4-hydroxycyclohexa-1,3-diene-1-carboxylate |
| SMILES | COC(=O)C1=CC=C(O)CC1 |
| InChI | InChI=1S/C8H10O3/c1-11-8(10)6-2-4-7(9)5-3-6/h2,4,9H,3,5H2,1H3 |
| InChIKey | FYYUTIMZGYLCHF-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.16 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 4-hydroxycyclohexa-1,3-diene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-hydroxycyclohexa-1,3-diene-1-carboxylate?
The IUPAC name of methyl 4-hydroxycyclohexa-1,3-diene-1-carboxylate (CID 89380670) is methyl 4-hydroxycyclohexa-1,3-diene-1-carboxylate.
What is the SMILES notation for methyl 4-hydroxycyclohexa-1,3-diene-1-carboxylate?
The canonical SMILES for methyl 4-hydroxycyclohexa-1,3-diene-1-carboxylate is COC(=O)C1=CC=C(O)CC1.
What is the InChIKey of methyl 4-hydroxycyclohexa-1,3-diene-1-carboxylate?
The InChIKey is FYYUTIMZGYLCHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O3/c1-11-8(10)6-2-4-7(9)5-3-6/h2,4,9H,3,5H2,1H3.
What are the key properties of methyl 4-hydroxycyclohexa-1,3-diene-1-carboxylate?
methyl 4-hydroxycyclohexa-1,3-diene-1-carboxylate has a molecular weight of 154.16 g/mol, XLogP of 1.32, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-hydroxycyclohexa-1,3-diene-1-carboxylate is sourced from PubChem (CID 89380670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).