C23H46O5Si — CID 89380708
ethyl (4R,5S,6S)-7-butoxy-5-[tert-butyl(dimethyl)silyl]oxy-2,2,4,6-tetramethyl-3-oxoheptanoate (PubChem CID 89380708) has the molecular formula C23H46O5Si and a molecular weight of 430.70 g/mol. Its IUPAC name is ethyl (4R,5S,6S)-7-butoxy-5-[tert-butyl(dimethyl)silyl]oxy-2,2,4,6-tetramethyl-3-oxoheptanoate.
| Compound Name | ethyl (4R,5S,6S)-7-butoxy-5-[tert-butyl(dimethyl)silyl]oxy-2,2,4,6-tetramethyl-3-oxoheptanoate |
|---|---|
| PubChem CID | 89380708 |
| Molecular Formula | C23H46O5Si |
| Molecular Weight | 430.70 g/mol |
| Exact Mass | 430.31 |
| IUPAC Name | ethyl (4R,5S,6S)-7-butoxy-5-[tert-butyl(dimethyl)silyl]oxy-2,2,4,6-tetramethyl-3-oxoheptanoate |
| SMILES | CCCCOC[C@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C(=O)C(C)(C)C(=O)OCC |
| InChI | InChI=1S/C23H46O5Si/c1-12-14-15-26-16-17(3)19(28-29(10,11)22(5,6)7)18(4)20(24)23(8,9)21(25)27-13-2/h17-19H,12-16H2,1-11H3/t17-,18+,19-/m0/s1 |
| InChIKey | PMVBUIGUZLFIJW-OTWHNJEPSA-N |
| XLogP | 5.62 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.70 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|