C36H63F3O6Si2 — CID 89380753
[(3S,5E)-2-oxo-6-(trifluoromethyl)nona-5,8-dien-3-yl] (3S,6R,7S,8S)-7-[tert-butyl(dimethyl)silyl]oxy-4,4,6,8-tetramethyl-5-oxo-3-triethylsilyloxydec-9-enoate (PubChem CID 89380753) has the molecular formula C36H63F3O6Si2 and a molecular weight of 705.06 g/mol. Its IUPAC name is [(3S,5E)-2-oxo-6-(trifluoromethyl)nona-5,8-dien-3-yl] (3S,6R,7S,8S)-7-[tert-butyl(dimethyl)silyl]oxy-4,4,6,8-tetramethyl-5-oxo-3-triethylsilyloxydec-9-enoate.
| Compound Name | [(3S,5E)-2-oxo-6-(trifluoromethyl)nona-5,8-dien-3-yl] (3S,6R,7S,8S)-7-[tert-butyl(dimethyl)silyl]oxy-4,4,6,8-tetramethyl-5-oxo-3-triethylsilyloxydec-9-enoate |
|---|---|
| PubChem CID | 89380753 |
| Molecular Formula | C36H63F3O6Si2 |
| Molecular Weight | 705.06 g/mol |
| Exact Mass | 704.41 |
| IUPAC Name | [(3S,5E)-2-oxo-6-(trifluoromethyl)nona-5,8-dien-3-yl] (3S,6R,7S,8S)-7-[tert-butyl(dimethyl)silyl]oxy-4,4,6,8-tetramethyl-5-oxo-3-triethylsilyloxydec-9-enoate |
| SMILES | C=CC/C(=C\C[C@H](OC(=O)C[C@H](O[Si](CC)(CC)CC)C(C)(C)C(=O)[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C=C)C(C)=O)C(F)(F)F |
| InChI | InChI=1S/C36H63F3O6Si2/c1-16-21-28(36(37,38)39)22-23-29(27(8)40)43-31(41)24-30(44-47(18-3,19-4)20-5)35(12,13)33(42)26(7)32(25(6)17-2)45-46(14,15)34(9,10)11/h16-17,22,25-26,29-30,32H,1-2,18-21,23-24H2,3-15H3/b28-22+/t25-,26+,29-,30-,32-/m0/s1 |
| InChIKey | BKWHVWFRBWAZMJ-GICDZGFWSA-N |
| XLogP | 10.17 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.06 |
| LogP ≤ 5 | 10.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|