C13H20F10N2 — CID 89380839
N',N'-dimethyl-N-[5,6,6,6-tetrafluoro-3,5-bis(trifluoromethyl)hexyl]propane-1,3-diamine (PubChem CID 89380839) has the molecular formula C13H20F10N2 and a molecular weight of 394.30 g/mol. Its IUPAC name is N',N'-dimethyl-N-[5,6,6,6-tetrafluoro-3,5-bis(trifluoromethyl)hexyl]propane-1,3-diamine.
| Compound Name | N',N'-dimethyl-N-[5,6,6,6-tetrafluoro-3,5-bis(trifluoromethyl)hexyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 89380839 |
| Molecular Formula | C13H20F10N2 |
| Molecular Weight | 394.30 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | N',N'-dimethyl-N-[5,6,6,6-tetrafluoro-3,5-bis(trifluoromethyl)hexyl]propane-1,3-diamine |
| SMILES | CN(C)CCCNCCC(CC(F)(C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C13H20F10N2/c1-25(2)7-3-5-24-6-4-9(11(15,16)17)8-10(14,12(18,19)20)13(21,22)23/h9,24H,3-8H2,1-2H3 |
| InChIKey | UPZSWEUXMZANNQ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.30 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|