C18H27F13N2 — CID 89380841
N',N'-dimethyl-N-[9,10,10,10-tetrafluoro-5,7,9-tris(trifluoromethyl)decyl]propane-1,3-diamine (PubChem CID 89380841) has the molecular formula C18H27F13N2 and a molecular weight of 518.40 g/mol. Its IUPAC name is N',N'-dimethyl-N-[9,10,10,10-tetrafluoro-5,7,9-tris(trifluoromethyl)decyl]propane-1,3-diamine.
| Compound Name | N',N'-dimethyl-N-[9,10,10,10-tetrafluoro-5,7,9-tris(trifluoromethyl)decyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 89380841 |
| Molecular Formula | C18H27F13N2 |
| Molecular Weight | 518.40 g/mol |
| Exact Mass | 518.20 |
| IUPAC Name | N',N'-dimethyl-N-[9,10,10,10-tetrafluoro-5,7,9-tris(trifluoromethyl)decyl]propane-1,3-diamine |
| SMILES | CN(C)CCCNCCCCC(CC(CC(F)(C(F)(F)F)C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C18H27F13N2/c1-33(2)9-5-8-32-7-4-3-6-12(15(20,21)22)10-13(16(23,24)25)11-14(19,17(26,27)28)18(29,30)31/h12-13,32H,3-11H2,1-2H3 |
| InChIKey | GLPCHFAITYXAJL-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.40 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|