C8H8F10O — CID 89380858
(3S)-5,6,6,6-tetrafluoro-3,5-bis(trifluoromethyl)hexan-1-ol (PubChem CID 89380858) has the molecular formula C8H8F10O and a molecular weight of 310.13 g/mol. Its IUPAC name is (3S)-5,6,6,6-tetrafluoro-3,5-bis(trifluoromethyl)hexan-1-ol.
| Compound Name | (3S)-5,6,6,6-tetrafluoro-3,5-bis(trifluoromethyl)hexan-1-ol |
|---|---|
| PubChem CID | 89380858 |
| Molecular Formula | C8H8F10O |
| Molecular Weight | 310.13 g/mol |
| Exact Mass | 310.04 |
| IUPAC Name | (3S)-5,6,6,6-tetrafluoro-3,5-bis(trifluoromethyl)hexan-1-ol |
| SMILES | OCC[C@@H](CC(F)(C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H8F10O/c9-5(7(13,14)15,8(16,17)18)3-4(1-2-19)6(10,11)12/h4,19H,1-3H2/t4-/m0/s1 |
| InChIKey | DVAFHCZGFVZZJT-BYPYZUCNSA-N |
| XLogP | 3.77 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.13 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |