C15H22F12N2 — CID 89380893
N-[5,5,7,8,8,8-hexafluoro-3,7-bis(trifluoromethyl)octyl]-N',N'-dimethylpropane-1,3-diamine (PubChem CID 89380893) has the molecular formula C15H22F12N2 and a molecular weight of 458.33 g/mol. Its IUPAC name is N-[5,5,7,8,8,8-hexafluoro-3,7-bis(trifluoromethyl)octyl]-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | N-[5,5,7,8,8,8-hexafluoro-3,7-bis(trifluoromethyl)octyl]-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 89380893 |
| Molecular Formula | C15H22F12N2 |
| Molecular Weight | 458.33 g/mol |
| Exact Mass | 458.16 |
| IUPAC Name | N-[5,5,7,8,8,8-hexafluoro-3,7-bis(trifluoromethyl)octyl]-N',N'-dimethylpropane-1,3-diamine |
| SMILES | CN(C)CCCNCCC(CC(F)(F)CC(F)(C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C15H22F12N2/c1-29(2)7-3-5-28-6-4-10(13(19,20)21)8-11(16,17)9-12(18,14(22,23)24)15(25,26)27/h10,28H,3-9H2,1-2H3 |
| InChIKey | RIMBYXORCRECFJ-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.33 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|