About 4-buta-2,3-dien-2-ylpiperidine
4-buta-2,3-dien-2-ylpiperidine (PubChem CID 89380984) has the molecular formula C9H15N
and a molecular weight of 137.23 g/mol. Its IUPAC name is 4-buta-2,3-dien-2-ylpiperidine.
Molecular Properties
| Compound Name | 4-buta-2,3-dien-2-ylpiperidine |
| PubChem CID | 89380984 |
| Molecular Formula | C9H15N |
| Molecular Weight | 137.23 g/mol |
| Exact Mass | 137.12 |
| IUPAC Name | 4-buta-2,3-dien-2-ylpiperidine |
| SMILES | C=C=C(C)C1CCNCC1 |
| InChI | InChI=1S/C9H15N/c1-3-8(2)9-4-6-10-7-5-9/h9-10H,1,4-7H2,2H3 |
| InChIKey | RNSGVWVNAIDJEU-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.23 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-buta-2,3-dien-2-ylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-buta-2,3-dien-2-ylpiperidine?
The IUPAC name of 4-buta-2,3-dien-2-ylpiperidine (CID 89380984) is 4-buta-2,3-dien-2-ylpiperidine.
What is the SMILES notation for 4-buta-2,3-dien-2-ylpiperidine?
The canonical SMILES for 4-buta-2,3-dien-2-ylpiperidine is C=C=C(C)C1CCNCC1.
What is the InChIKey of 4-buta-2,3-dien-2-ylpiperidine?
The InChIKey is RNSGVWVNAIDJEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N/c1-3-8(2)9-4-6-10-7-5-9/h9-10H,1,4-7H2,2H3.
What are the key properties of 4-buta-2,3-dien-2-ylpiperidine?
4-buta-2,3-dien-2-ylpiperidine has a molecular weight of 137.23 g/mol, XLogP of 1.72, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-buta-2,3-dien-2-ylpiperidine is sourced from PubChem (CID 89380984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).