C27H30ClN5O4 — CID 89381216
N'-[3-chloro-4-(pyridin-2-ylmethoxy)phenyl]-5-[1-(2-hydroxyacetyl)piperidin-4-yl]oxy-2-(methylamino)benzenecarboximidamide (PubChem CID 89381216) has the molecular formula C27H30ClN5O4 and a molecular weight of 524.02 g/mol. Its IUPAC name is N'-[3-chloro-4-(pyridin-2-ylmethoxy)phenyl]-5-[1-(2-hydroxyacetyl)piperidin-4-yl]oxy-2-(methylamino)benzenecarboximidamide.
| Compound Name | N'-[3-chloro-4-(pyridin-2-ylmethoxy)phenyl]-5-[1-(2-hydroxyacetyl)piperidin-4-yl]oxy-2-(methylamino)benzenecarboximidamide |
|---|---|
| PubChem CID | 89381216 |
| Molecular Formula | C27H30ClN5O4 |
| Molecular Weight | 524.02 g/mol |
| Exact Mass | 523.20 |
| IUPAC Name | N'-[3-chloro-4-(pyridin-2-ylmethoxy)phenyl]-5-[1-(2-hydroxyacetyl)piperidin-4-yl]oxy-2-(methylamino)benzenecarboximidamide |
| SMILES | CNc1ccc(OC2CCN(C(=O)CO)CC2)cc1/C(N)=N/c1ccc(OCc2ccccn2)c(Cl)c1 |
| InChI | InChI=1S/C27H30ClN5O4/c1-30-24-7-6-21(37-20-9-12-33(13-10-20)26(35)16-34)15-22(24)27(29)32-18-5-8-25(23(28)14-18)36-17-19-4-2-3-11-31-19/h2-8,11,14-15,20,30,34H,9-10,12-13,16-17H2,1H3,(H2,29,32) |
| InChIKey | GNQVFQNPXIKZGB-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 122.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.02 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|