About 2-ethyl-5-(2,3,3-trimethylbutan-2-yl)-1,3,4-oxadiazole
2-ethyl-5-(2,3,3-trimethylbutan-2-yl)-1,3,4-oxadiazole (PubChem CID 89381364) has the molecular formula C11H20N2O
and a molecular weight of 196.29 g/mol. Its IUPAC name is 2-ethyl-5-(2,3,3-trimethylbutan-2-yl)-1,3,4-oxadiazole.
Analyze 2-ethyl-5-(2,3,3-trimethylbutan-2-yl)-1,3,4-oxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-5-(2,3,3-trimethylbutan-2-yl)-1,3,4-oxadiazole?
The IUPAC name of 2-ethyl-5-(2,3,3-trimethylbutan-2-yl)-1,3,4-oxadiazole (CID 89381364) is 2-ethyl-5-(2,3,3-trimethylbutan-2-yl)-1,3,4-oxadiazole.
What is the SMILES notation for 2-ethyl-5-(2,3,3-trimethylbutan-2-yl)-1,3,4-oxadiazole?
The canonical SMILES for 2-ethyl-5-(2,3,3-trimethylbutan-2-yl)-1,3,4-oxadiazole is CCc1nnc(C(C)(C)C(C)(C)C)o1.
What is the InChIKey of 2-ethyl-5-(2,3,3-trimethylbutan-2-yl)-1,3,4-oxadiazole?
The InChIKey is HDZNIBXMKBXVTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N2O/c1-7-8-12-13-9(14-8)11(5,6)10(2,3)4/h7H2,1-6H3.
What are the key properties of 2-ethyl-5-(2,3,3-trimethylbutan-2-yl)-1,3,4-oxadiazole?
2-ethyl-5-(2,3,3-trimethylbutan-2-yl)-1,3,4-oxadiazole has a molecular weight of 196.29 g/mol, XLogP of 2.96, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-5-(2,3,3-trimethylbutan-2-yl)-1,3,4-oxadiazole is sourced from PubChem (CID 89381364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).