C9H14N2 — CID 89381391
(2E,6E,8Z)-2-methyl-4,5-dihydroazonin-1-amine (PubChem CID 89381391) has the molecular formula C9H14N2 and a molecular weight of 150.22 g/mol. Its IUPAC name is (2E,6E,8Z)-2-methyl-4,5-dihydroazonin-1-amine.
| Compound Name | (2E,6E,8Z)-2-methyl-4,5-dihydroazonin-1-amine |
|---|---|
| PubChem CID | 89381391 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | (2E,6E,8Z)-2-methyl-4,5-dihydroazonin-1-amine |
| SMILES | C/C1=C\CC/C=C/C=C\N1N |
| InChI | InChI=1S/C9H14N2/c1-9-7-5-3-2-4-6-8-11(9)10/h2,4,6-8H,3,5,10H2,1H3/b4-2+,8-6-,9-7+ |
| InChIKey | ZRDDVXMNDGOEAY-PCIJFARRSA-N |
| XLogP | 1.93 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|