C12H24N2 — CID 89381425
1-methyl-1-[(4S,5Z)-2,3,3-trimethylocta-1,5-dien-4-yl]hydrazine (PubChem CID 89381425) has the molecular formula C12H24N2 and a molecular weight of 196.34 g/mol. Its IUPAC name is 1-methyl-1-[(4S,5Z)-2,3,3-trimethylocta-1,5-dien-4-yl]hydrazine.
| Compound Name | 1-methyl-1-[(4S,5Z)-2,3,3-trimethylocta-1,5-dien-4-yl]hydrazine |
|---|---|
| PubChem CID | 89381425 |
| Molecular Formula | C12H24N2 |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.19 |
| IUPAC Name | 1-methyl-1-[(4S,5Z)-2,3,3-trimethylocta-1,5-dien-4-yl]hydrazine |
| SMILES | C=C(C)C(C)(C)[C@H](/C=C\CC)N(C)N |
| InChI | InChI=1S/C12H24N2/c1-7-8-9-11(14(6)13)12(4,5)10(2)3/h8-9,11H,2,7,13H2,1,3-6H3/b9-8-/t11-/m0/s1 |
| InChIKey | SCCCBRYVGHHRDL-IQQGHNRFSA-N |
| XLogP | 2.73 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|